 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 47CALCIUM MALATE |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-12-24 15:17 |
| |
 |
|
CALCIUM MALATE
| Category: |
Other Chemicals/Others |
|
| CAS NO: |
17482-42-7 |
| EC NO: |
241-498-1 |
| Molecular Formula: |
C4H4CaO5
|
| Molecular Weight: |
172.1496 |
| Specification: |
|
| InChI: |
InChI=1/C4H6O5.Ca/c5-2(4(8)9)1-3(6)7;/h2,5H,1H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| Synonyms: |
butanedioate, 2-hydroxy-, calcium hydrogen salt (2:1:2);butanedioic acid, 2-hydroxy-, calcium salt (2:1);Calcium bis(3-carboxy-2-hydroxypropanoate);Calcium hydrogen 2-hydroxysuccinate (1:2:2);calcium 2-hydroxybutanedioate; |
| Molecular Structure: |
 |
|
